EnumPrinters Function

Declare Function EnumPrinters Lib "winspool.drv" Alias "EnumPrintersA" (ByVal flags As Long, ByVal name As String, ByVal Level As Long, pPrinterEnum As Long, ByVal cdBuf As Long, pcbNeeded As Long, pcReturned As Long) As Long

Platforms: Win 95/98, Win NT

EnumPrinters finds and returns information about one or more printers which the computer has access to. These include both local printers (physically connected to the machine) and network printers (accessible via the network). Under Win 95/98, the information can be passed in a PRINTER_INFO_1, PRINTER_INFO_2, or PRINTER_INFO_5 structure. Under Win NT, the information can be passed in a PRINTER_INFO_1, PRINTER_INFO_2, or PRINTER_INFO_4 structure. Note that structures 4 and 5 are the quickest ones to use. The attributes of the chosen structure determine what kinds of information about the printer(s) is returned. The information itself is put into the array passed as pPrinterEnum, which can then be copied into an array of data structures. The function returns 1 if successful, or 0 if an error occured.

Note for Visual Basic users: Due to limitations in the Visual Basic language, it is impossible to pass an array of PRINTER_INFO_* structures as pPrinterEnum -- the array must be of Long-type elements. Also, for some reason the CopyMemory function cannot be used to successfully transfer the array information into the structure. Instead, each individual member of the data structure must be set manually. Look at the two examples for details how. In order to convert a Long-type string pointer (in the array) to a string, variants of the lstrcpy and lstrlen function must be used. Again, see the examples. CopyMemory, however, can be used to copy the data structures which make up parts of the PRINTER_INFO_2 data structure.

flags
One or more of the following flags specifying which printers to find information about (note that PRINTER_ENUM_LOCAL and PRINTER_ENUM_CONNECTIONS are the only valid flags when using PRINTER_INFO_4):
PRINTER_ENUM_CONNECTIONS = &H4
Win NT only: Get information about the network printers which the computer has made connections to.
PRINTER_ENUM_DEFAULT = &H1
Win 95/98 only: Get information about the computer's default printer.
PRINTER_ENUM_LOCAL = &H2
Get information about local printers (the ones directly connected to the system). Win 95/98 for some reason also considers network printers to be local.
PRINTER_ENUM_NAME = &H8
Get information about all the printers under the network domain specified by name.
PRINTER_ENUM_NETWORK = &H40
Win NT only: Get information about all the printers under the computer's domain in the network. This only works with the PRINTER_INFO_1 structure.
PRINTER_ENUM_REMOTE = &H10
Win NT only: Same as PRINTER_ENUM_NETWORK.
PRINTER_ENUM_SHARED = &H20
Get information about all the printers with the shared attribute.
name
The name of the network domain to look under, if applicable. See flags to see when this would be used. If not used, set this parameter to an empty string.
Level
Specifies which PRINTER_INFO_* structure to use. For Win 95/98, this can be 1, 2, or 5. For Win NT, this can be 1, 2, or 4.
pPrinterEnum
An array which receives all of the information found by the function. This needs to be copied manually into the PRINTER_INFO_* structure.
cdBuf
The size in bytes of the array passed as pPrinterEnum.
pcbNeeded
If successful, receives the number of bytes of information the function found. If unsuccessful, receives the number of bytes that pPrinterEnum must have in order to receive all of the information.
pcReturned
Receives the number of printers found by the function.

Example #1:

' Get information about all of the local printers using structure 1.  Note how
' the elements of the array are loaded into an array of data structures manually.  Also
' note how the following special declares must be used to allow numeric string pointers
' to be used in place of strings:
Declare Function lstrcpy Lib "kernel32.dll" Alias "lstrcpyA" (ByVal lpString1 As String, ByVal lpString2 As Long) As Long
Declare Function lstrlen Lib "kernel32.dll" Alias "lstrlenA" (ByVal lpString As Long) As Long

Dim longbuffer() As Long  ' resizable array receives information from the function
Dim printinfo() As PRINTER_INFO_1  ' values inside longbuffer() will be put into here
Dim numbytes As Long  ' size in bytes of longbuffer()
Dim numneeded As Long  ' receives number of bytes necessary if longbuffer() is too small
Dim numprinters As Long  ' receives number of printers found
Dim c As Integer, retval As Long  ' counter variable & return value

' Get information about the local printers
numbytes = 3076  ' should be sufficiently big, but it may not be
ReDim longbuffer(0 To numbytes / 4) As Long  ' resize array -- note how 1 Long = 4 bytes
retval = EnumPrinters(PRINTER_ENUM_LOCAL, "", 1, longbuffer(0), numbytes, numneeded, numprinters)
If retval = 0 Then  ' try enlarging longbuffer() to receive all necessary information
  numbytes = numneeded
  ReDim longbuffer(0 To numbytes / 4) As Long  ' make it large enough
  retval = EnumPrinters(PRINTER_ENUM_LOCAL, "", 1, longbuffer(0), numbytes, numneeded, numprinters)
  If retval = 0  ' failed again!
    Debug.Print "Could not successfully enumerate the printes."
    End  ' abort program
  End If
End If

' Convert longbuffer() data into printinfo()
ReDim printinfo(0 To numprinters - 1) As PRINTER_INFO_1  ' room for each printer
For c = 0 To numprinters - 1  ' loop, putting each set of information into each element
  ' longbuffer(4 * c) = .flags, longbuffer(4 * c + 1) = .pDescription, etc.
  ' For each string, the string is first buffered to provide enough room, and then the string is copied.
  printinfo(c).flags = longbuffer(4 * c)
  printinfo(c).pDescription = Space(lstrlen(longbuffer(4 * c + 1)))
  retval = lstrcpy(printinfo(c).pDescription, longbuffer(4 * c + 1))
  printinfo(c).pName = Space(lstrlen(longbuffer(4 * c + 2)))
  retval = lstrcpy(printinfo(c).pName, longbuffer(4 * c + 2))
  printinfo(c).pComment = Space(lstrlen(longbuffer(4 * c + 3)))
  retval = lstrcpy(printinfo(c).pComment, longbuffer(4 * c + 3))
Next c

' Display name of each printer
For c = 0 To numprinters - 1
  Debug.Print "Name of printer"; c + 1; " is: "; printinfo(c).pName
Next c

Example #2:

' Get information about all of the local printers using structure 2.  Note how
' the elements of the array are loaded into an array of data structures manually.  Also
' note how the following special declares must be used to allow numeric string pointers
' to be used in place of strings:
Declare Function lstrcpy Lib "kernel32.dll" Alias "lstrcpyA" (ByVal lpString1 As String, ByVal lpString2 As Long) As Long
Declare Function lstrlen Lib "kernel32.dll" Alias "lstrlenA" (ByVal lpString As Long) As Long

Dim longbuffer() As Long  ' resizable array receives information from the function
Dim printinfo() As PRINTER_INFO_2  ' values inside longbuffer() will be put into here
Dim numbytes As Long  ' size in bytes of longbuffer()
Dim numneeded As Long  ' receives number of bytes necessary if longbuffer() is too small
Dim numprinters As Long  ' receives number of printers found
Dim c As Integer, retval As Long  ' counter variable & return value

' Get information about the local printers
numbytes = 3076  ' should be sufficiently big, but it may not be
ReDim longbuffer(0 To numbytes / 4) As Long  ' resize array -- note how 1 Long = 4 bytes
retval = EnumPrinters(PRINTER_ENUM_LOCAL, "", 2, longbuffer(0), numbytes, numneeded, numprinters)
If retval = 0 Then  ' try enlarging longbuffer() to receive all necessary information
  numbytes = numneeded
  ReDim longbuffer(0 To numbytes / 4) As Long  ' make it large enough
  retval = EnumPrinters(PRINTER_ENUM_LOCAL, "", 2, longbuffer(0), numbytes, numneeded, numprinters)
  If retval = 0  ' failed again!
    Debug.Print "Could not successfully enumerate the printes."
    End  ' abort program
  End If
End If

' Convert longbuffer() data into printinfo()
ReDim printinfo(0 To numprinters - 1) As PRINTER_INFO_2  ' room for each printer
For c = 0 To numprinters - 1  ' loop, putting each set of information into each element
  ' longbuffer(21 * c) = .pServerName, longbuffer(21 * c + 1) = .pPrinterName, etc.
  ' For each string, the string is first buffered to provide enough room, and then the string is copied.
  ' For each structure, the memory of it is directly copied via CopyMemory using the pointer.
  printinfo(c).pServerName = Space(lstrlen(longbuffer(21 * c)))
  retval = lstrcpy(printinfo(c).pServerName, longbuffer(21 * c))
  printinfo(c).pPrinterName = Space(lstrlen(longbuffer(21 * c + 1)))
  retval = lstrcpy(printinfo(c).pPrinterName, longbuffer(21 * c + 1))
  printinfo(c).pShareName = Space(lstrlen(longbuffer(21 * c + 2)))
  retval = lstrcpy(printinfo(c).pShareName, longbuffer(21 * c + 2))
  printinfo(c).pPortName = Space(lstrlen(longbuffer(21 * c + 3)))
  retval = lstrcpy(printinfo(c).pPortName, longbuffer(21 * c + 3))
  printinfo(c).pDriverName = Space(lstrlen(longbuffer(21 * c + 4)))
  retval = lstrcpy(printinfo(c).pDriverName, longbuffer(21 * c + 4))
  printinfo(c).pComment = Space(lstrlen(longbuffer(21 * c + 5)))
  retval = lstrcpy(printinfo(c).pComment, longbuffer(21 * c + 5))
  printinfo(c).pLocation = Space(lstrlen(longbuffer(21 * c + 6)))
  retval = lstrcpy(printinfo(c).pLocation, longbuffer(21 * c + 6))
  CopyMemory printinfo(c).pDevMode, longbuffer(21 * c + 7), Len(printinfo(c).pDevMode)
  printinfo(c).pSepFile = Space(lstrlen(longbuffer(21 * c + 8)))
  retval = lstrcpy(printinfo(c).pSepFile, longbuffer(21 * c + 8))
  printinfo(c).pPrintProcessor = Space(lstrlen(longbuffer(21 * c + 9)))
  retval = lstrcpy(printinfo(c).pPrintProcessor, longbuffer(21 * c + 9))
  printinfo(c).pDatatype = Space(lstrlen(longbuffer(21 * c + 10)))
  retval = lstrcpy(printinfo(c).pDatatype, longbuffer(21 * c + 10))
  printinfo(c).pParameters = Space(lstrlen(longbuffer(21 * c + 11)))
  retval = lstrcpy(printinfo(c).pParameters, longbuffer(21 * c + 11))
  CopyMemory printinfo(c).pSecurityDescriptor, longbuffer(21 * c + 12), Len(printinfo(c).pSecurityDescriptor)
  printinfo(c).Attributes = longbuffer(21 * c + 13)
  printinfo(c).Priority = longbuffer(21 * c + 14)
  printinfo(c).DefaultPriority = longbuffer(21 * c + 15)
  printinfo(c).StartTime = longbuffer(21 * c + 16)
  printinfo(c).UntilTime = longbuffer(21 * c + 17)
  printinfo(c).Status = longbuffer(21 * c + 18)
  printinfo(c).cJobs = longbuffer(21 * c + 19)
  printinfo(c).AveragePPM = longbuffer(21 * c + 20)
Next c

' Display the name of each printer and its average page per minute (ppm) rate
For c = 0 To numprinters - 1
  Debug.Print printinfo(c).pPrinterName; " prints an average of"; printinfo(c).AveragePPM; "pages per minute."
Next c

Category: Printers
Back to the index.


Go to Paul Kuliniewicz's Home Page.
E-mail: rogue953@hotmail.com
This page is at http://skyscraper.fortunecity.com/transmission/45/api/e/enumprinters.html